C29H34N2O5 — CID 139720777
1-(dibenzylamino)ethyl 4-[(4-methoxyphenyl)methoxycarbonylamino]butanoate (PubChem CID 139720777) has the molecular formula C29H34N2O5 and a molecular weight of 490.60 g/mol. Its IUPAC name is 1-(dibenzylamino)ethyl 4-[(4-methoxyphenyl)methoxycarbonylamino]butanoate.
| Compound Name | 1-(dibenzylamino)ethyl 4-[(4-methoxyphenyl)methoxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 139720777 |
| Molecular Formula | C29H34N2O5 |
| Molecular Weight | 490.60 g/mol |
| Exact Mass | 490.25 |
| IUPAC Name | 1-(dibenzylamino)ethyl 4-[(4-methoxyphenyl)methoxycarbonylamino]butanoate |
| SMILES | COc1ccc(COC(=O)NCCCC(=O)OC(C)N(Cc2ccccc2)Cc2ccccc2)cc1 |
| InChI | InChI=1S/C29H34N2O5/c1-23(31(20-24-10-5-3-6-11-24)21-25-12-7-4-8-13-25)36-28(32)14-9-19-30-29(33)35-22-26-15-17-27(34-2)18-16-26/h3-8,10-13,15-18,23H,9,14,19-22H2,1-2H3,(H,30,33) |
| InChIKey | CIXTYMZWDVFDGH-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.60 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|