C19H15F5O3 — CID 138517790
(2,3,4,5,6-pentafluorophenyl) 6-oxo-7-phenylheptanoate (PubChem CID 138517790) has the molecular formula C19H15F5O3 and a molecular weight of 386.32 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 6-oxo-7-phenylheptanoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 6-oxo-7-phenylheptanoate |
|---|---|
| PubChem CID | 138517790 |
| Molecular Formula | C19H15F5O3 |
| Molecular Weight | 386.32 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 6-oxo-7-phenylheptanoate |
| SMILES | O=C(CCCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F)Cc1ccccc1 |
| InChI | InChI=1S/C19H15F5O3/c20-14-15(21)17(23)19(18(24)16(14)22)27-13(26)9-5-4-8-12(25)10-11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-10H2 |
| InChIKey | JBYBEGIBDPIUPO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.32 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|