C44H33F15O12 — CID 146728014
benzyl 5-oxo-8-[3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propoxy]-7,7-bis[[3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propoxy]methyl]octanoate (PubChem CID 146728014) has the molecular formula C44H33F15O12 and a molecular weight of 1038.71 g/mol. Its IUPAC name is benzyl 5-oxo-8-[3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propoxy]-7,7-bis[[3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propoxy]methyl]octanoate.
| Compound Name | benzyl 5-oxo-8-[3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propoxy]-7,7-bis[[3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propoxy]methyl]octanoate |
|---|---|
| PubChem CID | 146728014 |
| Molecular Formula | C44H33F15O12 |
| Molecular Weight | 1038.71 g/mol |
| Exact Mass | 1038.17 |
| IUPAC Name | benzyl 5-oxo-8-[3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propoxy]-7,7-bis[[3-oxo-3-(2,3,4,5,6-pentafluorophenoxy)propoxy]methyl]octanoate |
| SMILES | O=C(CCCC(=O)OCc1ccccc1)CC(COCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F)(COCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F)COCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C44H33F15O12/c45-26-29(48)35(54)41(36(55)30(26)49)69-23(62)9-12-65-17-44(15-21(60)7-4-8-22(61)68-16-20-5-2-1-3-6-20,18-66-13-10-24(63)70-42-37(56)31(50)27(46)32(51)38(42)57)19-67-14-11-25(64)71-43-39(58)33(52)28(47)34(53)40(43)59/h1-3,5-6H,4,7-19H2 |
| InChIKey | RGWJIRPWPXLFGI-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 71 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1038.71 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|