C21H21F4NO4 — CID 170630566
(2,3,5,6-tetrafluorophenyl) 8-[(2-hydroxybenzoyl)amino]octanoate (PubChem CID 170630566) has the molecular formula C21H21F4NO4 and a molecular weight of 427.39 g/mol. Its IUPAC name is (2,3,5,6-tetrafluorophenyl) 8-[(2-hydroxybenzoyl)amino]octanoate.
| Compound Name | (2,3,5,6-tetrafluorophenyl) 8-[(2-hydroxybenzoyl)amino]octanoate |
|---|---|
| PubChem CID | 170630566 |
| Molecular Formula | C21H21F4NO4 |
| Molecular Weight | 427.39 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | (2,3,5,6-tetrafluorophenyl) 8-[(2-hydroxybenzoyl)amino]octanoate |
| SMILES | O=C(CCCCCCCNC(=O)c1ccccc1O)Oc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C21H21F4NO4/c22-14-12-15(23)19(25)20(18(14)24)30-17(28)10-4-2-1-3-7-11-26-21(29)13-8-5-6-9-16(13)27/h5-6,8-9,12,27H,1-4,7,10-11H2,(H,26,29) |
| InChIKey | FPXXSPWYKJECLA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.39 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|