C18H26N2O4 — CID 163501379
2-hydroxy-N-(11-nitroso-11-oxoundecyl)benzamide (PubChem CID 163501379) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-hydroxy-N-(11-nitroso-11-oxoundecyl)benzamide.
| Compound Name | 2-hydroxy-N-(11-nitroso-11-oxoundecyl)benzamide |
|---|---|
| PubChem CID | 163501379 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 2-hydroxy-N-(11-nitroso-11-oxoundecyl)benzamide |
| SMILES | O=NC(=O)CCCCCCCCCCNC(=O)c1ccccc1O |
| InChI | InChI=1S/C18H26N2O4/c21-16-12-9-8-11-15(16)18(23)19-14-10-6-4-2-1-3-5-7-13-17(22)20-24/h8-9,11-12,21H,1-7,10,13-14H2,(H,19,23) |
| InChIKey | CVAWTULKQYETCY-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|