C13H21IN2O2 — CID 17387279
3-[(2-hydroxybenzoyl)amino]propyl-trimethylazanium iodide (PubChem CID 17387279) has the molecular formula C13H21IN2O2 and a molecular weight of 364.23 g/mol. Its IUPAC name is 3-[(2-hydroxybenzoyl)amino]propyl-trimethylazanium iodide.
| Compound Name | 3-[(2-hydroxybenzoyl)amino]propyl-trimethylazanium iodide |
|---|---|
| PubChem CID | 17387279 |
| Molecular Formula | C13H21IN2O2 |
| Molecular Weight | 364.23 g/mol |
| Exact Mass | 364.06 |
| IUPAC Name | 3-[(2-hydroxybenzoyl)amino]propyl-trimethylazanium iodide |
| SMILES | C[N+](C)(C)CCCNC(=O)c1ccccc1O.[I-] |
| InChI | InChI=1S/C13H20N2O2.HI/c1-15(2,3)10-6-9-14-13(17)11-7-4-5-8-12(11)16;/h4-5,7-8H,6,9-10H2,1-3H3,(H-,14,16,17);1H |
| InChIKey | SUEIQBWIAVBKPZ-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.23 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|