C15H24N2O4 — CID 171364107
azanium 8-[(2-hydroxybenzoyl)amino]octanoate (PubChem CID 171364107) has the molecular formula C15H24N2O4 and a molecular weight of 296.37 g/mol. Its IUPAC name is azanium 8-[(2-hydroxybenzoyl)amino]octanoate.
| Compound Name | azanium 8-[(2-hydroxybenzoyl)amino]octanoate |
|---|---|
| PubChem CID | 171364107 |
| Molecular Formula | C15H24N2O4 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | azanium 8-[(2-hydroxybenzoyl)amino]octanoate |
| SMILES | O=C([O-])CCCCCCCNC(=O)c1ccccc1O.[NH4+] |
| InChI | InChI=1S/C15H21NO4.H3N/c17-13-9-6-5-8-12(13)15(20)16-11-7-3-1-2-4-10-14(18)19;/h5-6,8-9,17H,1-4,7,10-11H2,(H,16,20)(H,18,19);1H3 |
| InChIKey | GWIATFJBJNPIEZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 125.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|