C11H11ClNO3- — CID 7024884
4-[(2-chlorobenzoyl)amino]butanoate (PubChem CID 7024884) has the molecular formula C11H11ClNO3- and a molecular weight of 240.67 g/mol. Its IUPAC name is 4-[(2-chlorobenzoyl)amino]butanoate.
| Compound Name | 4-[(2-chlorobenzoyl)amino]butanoate |
|---|---|
| PubChem CID | 7024884 |
| Molecular Formula | C11H11ClNO3- |
| Molecular Weight | 240.67 g/mol |
| Exact Mass | 240.04 |
| IUPAC Name | 4-[(2-chlorobenzoyl)amino]butanoate |
| SMILES | O=C([O-])CCCNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C11H12ClNO3/c12-9-5-2-1-4-8(9)11(16)13-7-3-6-10(14)15/h1-2,4-5H,3,6-7H2,(H,13,16)(H,14,15)/p-1 |
| InChIKey | DIHHUKVWXKEHDJ-UHFFFAOYSA-M |
| XLogP | 0.60 |
| TPSA | 69.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.67 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|