C18H16ClN2O5- — CID 2281559
4-[[(E)-2-[(2-chlorobenzoyl)amino]-3-(furan-2-yl)prop-2-enoyl]amino]butanoate (PubChem CID 2281559) has the molecular formula C18H16ClN2O5- and a molecular weight of 375.79 g/mol. Its IUPAC name is 4-[[(E)-2-[(2-chlorobenzoyl)amino]-3-(furan-2-yl)prop-2-enoyl]amino]butanoate.
| Compound Name | 4-[[(E)-2-[(2-chlorobenzoyl)amino]-3-(furan-2-yl)prop-2-enoyl]amino]butanoate |
|---|---|
| PubChem CID | 2281559 |
| Molecular Formula | C18H16ClN2O5- |
| Molecular Weight | 375.79 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 4-[[(E)-2-[(2-chlorobenzoyl)amino]-3-(furan-2-yl)prop-2-enoyl]amino]butanoate |
| SMILES | O=C([O-])CCCNC(=O)/C(=C\c1ccco1)NC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C18H17ClN2O5/c19-14-7-2-1-6-13(14)17(24)21-15(11-12-5-4-10-26-12)18(25)20-9-3-8-16(22)23/h1-2,4-7,10-11H,3,8-9H2,(H,20,25)(H,21,24)(H,22,23)/p-1/b15-11+ |
| InChIKey | BNRYRSDHLOTUQX-RVDMUPIBSA-M |
| XLogP | 1.35 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.79 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|