C22H23N2O5- — CID 7493238
6-[[(E)-3-(furan-2-yl)-2-[[(E)-3-phenylprop-2-enoyl]amino]prop-2-enoyl]amino]hexanoate (PubChem CID 7493238) has the molecular formula C22H23N2O5- and a molecular weight of 395.44 g/mol. Its IUPAC name is 6-[[(E)-3-(furan-2-yl)-2-[[(E)-3-phenylprop-2-enoyl]amino]prop-2-enoyl]amino]hexanoate.
| Compound Name | 6-[[(E)-3-(furan-2-yl)-2-[[(E)-3-phenylprop-2-enoyl]amino]prop-2-enoyl]amino]hexanoate |
|---|---|
| PubChem CID | 7493238 |
| Molecular Formula | C22H23N2O5- |
| Molecular Weight | 395.44 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 6-[[(E)-3-(furan-2-yl)-2-[[(E)-3-phenylprop-2-enoyl]amino]prop-2-enoyl]amino]hexanoate |
| SMILES | O=C([O-])CCCCCNC(=O)/C(=C\c1ccco1)NC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C22H24N2O5/c25-20(13-12-17-8-3-1-4-9-17)24-19(16-18-10-7-15-29-18)22(28)23-14-6-2-5-11-21(26)27/h1,3-4,7-10,12-13,15-16H,2,5-6,11,14H2,(H,23,28)(H,24,25)(H,26,27)/p-1/b13-12+,19-16+ |
| InChIKey | KLTMWLZODQIWQE-DKLJFVBZSA-M |
| XLogP | 1.88 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.44 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|