C19H20N2O4 — CID 7480372
(Z)-3-(furan-2-yl)-N-(3-hydroxypropyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]prop-2-enamide (PubChem CID 7480372) has the molecular formula C19H20N2O4 and a molecular weight of 340.38 g/mol. Its IUPAC name is (Z)-3-(furan-2-yl)-N-(3-hydroxypropyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]prop-2-enamide.
| Compound Name | (Z)-3-(furan-2-yl)-N-(3-hydroxypropyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]prop-2-enamide |
|---|---|
| PubChem CID | 7480372 |
| Molecular Formula | C19H20N2O4 |
| Molecular Weight | 340.38 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | (Z)-3-(furan-2-yl)-N-(3-hydroxypropyl)-2-[[(E)-3-phenylprop-2-enoyl]amino]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)N/C(=C\c1ccco1)C(=O)NCCCO |
| InChI | InChI=1S/C19H20N2O4/c22-12-5-11-20-19(24)17(14-16-8-4-13-25-16)21-18(23)10-9-15-6-2-1-3-7-15/h1-4,6-10,13-14,22H,5,11-12H2,(H,20,24)(H,21,23)/b10-9+,17-14- |
| InChIKey | JUEDPFVIXYAJPP-BBFBKMQUSA-N |
| XLogP | 1.95 |
| TPSA | 91.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.38 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|