C15H15BrN2O5 — CID 2919273
5-bromo-N-[1-(furan-2-yl)-3-(3-hydroxypropylamino)-3-oxoprop-1-en-2-yl]furan-2-carboxamide (PubChem CID 2919273) has the molecular formula C15H15BrN2O5 and a molecular weight of 383.20 g/mol. Its IUPAC name is 5-bromo-N-[1-(furan-2-yl)-3-(3-hydroxypropylamino)-3-oxoprop-1-en-2-yl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[1-(furan-2-yl)-3-(3-hydroxypropylamino)-3-oxoprop-1-en-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 2919273 |
| Molecular Formula | C15H15BrN2O5 |
| Molecular Weight | 383.20 g/mol |
| Exact Mass | 382.02 |
| IUPAC Name | 5-bromo-N-[1-(furan-2-yl)-3-(3-hydroxypropylamino)-3-oxoprop-1-en-2-yl]furan-2-carboxamide |
| SMILES | O=C(NCCCO)C(=Cc1ccco1)NC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C15H15BrN2O5/c16-13-5-4-12(23-13)15(21)18-11(9-10-3-1-8-22-10)14(20)17-6-2-7-19/h1,3-5,8-9,19H,2,6-7H2,(H,17,20)(H,18,21) |
| InChIKey | MIMJITNLPUQSAZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 104.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.20 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|