C19H12BrN2O6- — CID 6971973
4-[[(E)-2-[(5-bromofuran-2-carbonyl)amino]-3-(furan-2-yl)prop-2-enoyl]amino]benzoate (PubChem CID 6971973) has the molecular formula C19H12BrN2O6- and a molecular weight of 444.22 g/mol. Its IUPAC name is 4-[[(E)-2-[(5-bromofuran-2-carbonyl)amino]-3-(furan-2-yl)prop-2-enoyl]amino]benzoate.
| Compound Name | 4-[[(E)-2-[(5-bromofuran-2-carbonyl)amino]-3-(furan-2-yl)prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 6971973 |
| Molecular Formula | C19H12BrN2O6- |
| Molecular Weight | 444.22 g/mol |
| Exact Mass | 442.99 |
| IUPAC Name | 4-[[(E)-2-[(5-bromofuran-2-carbonyl)amino]-3-(furan-2-yl)prop-2-enoyl]amino]benzoate |
| SMILES | O=C(Nc1ccc(C(=O)[O-])cc1)/C(=C\c1ccco1)NC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C19H13BrN2O6/c20-16-8-7-15(28-16)18(24)22-14(10-13-2-1-9-27-13)17(23)21-12-5-3-11(4-6-12)19(25)26/h1-10H,(H,21,23)(H,22,24)(H,25,26)/p-1/b14-10+ |
| InChIKey | VHHOJBQZHAUFIJ-GXDHUFHOSA-M |
| XLogP | 2.41 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.22 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|