C17H17BrN2O6 — CID 7122484
(2S)-2-[[(Z)-2-[(5-bromofuran-2-carbonyl)amino]-3-(furan-2-yl)prop-2-enoyl]amino]-3-methylbutanoic acid (PubChem CID 7122484) has the molecular formula C17H17BrN2O6 and a molecular weight of 425.24 g/mol. Its IUPAC name is (2S)-2-[[(Z)-2-[(5-bromofuran-2-carbonyl)amino]-3-(furan-2-yl)prop-2-enoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[(Z)-2-[(5-bromofuran-2-carbonyl)amino]-3-(furan-2-yl)prop-2-enoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 7122484 |
| Molecular Formula | C17H17BrN2O6 |
| Molecular Weight | 425.24 g/mol |
| Exact Mass | 424.03 |
| IUPAC Name | (2S)-2-[[(Z)-2-[(5-bromofuran-2-carbonyl)amino]-3-(furan-2-yl)prop-2-enoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@H](NC(=O)/C(=C/c1ccco1)NC(=O)c1ccc(Br)o1)C(=O)O |
| InChI | InChI=1S/C17H17BrN2O6/c1-9(2)14(17(23)24)20-15(21)11(8-10-4-3-7-25-10)19-16(22)12-5-6-13(18)26-12/h3-9,14H,1-2H3,(H,19,22)(H,20,21)(H,23,24)/b11-8-/t14-/m0/s1 |
| InChIKey | KDCZJTGZJYAWRL-MSKHEQNASA-N |
| XLogP | 2.63 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.24 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|