C19H18Br2N2O5 — CID 40879367
(2R)-2-[[(E)-2-[(5-bromofuran-2-carbonyl)amino]-3-(4-bromophenyl)prop-2-enoyl]amino]-3-methylbutanoic acid (PubChem CID 40879367) has the molecular formula C19H18Br2N2O5 and a molecular weight of 514.17 g/mol. Its IUPAC name is (2R)-2-[[(E)-2-[(5-bromofuran-2-carbonyl)amino]-3-(4-bromophenyl)prop-2-enoyl]amino]-3-methylbutanoic acid.
| Compound Name | (2R)-2-[[(E)-2-[(5-bromofuran-2-carbonyl)amino]-3-(4-bromophenyl)prop-2-enoyl]amino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 40879367 |
| Molecular Formula | C19H18Br2N2O5 |
| Molecular Weight | 514.17 g/mol |
| Exact Mass | 511.96 |
| IUPAC Name | (2R)-2-[[(E)-2-[(5-bromofuran-2-carbonyl)amino]-3-(4-bromophenyl)prop-2-enoyl]amino]-3-methylbutanoic acid |
| SMILES | CC(C)[C@@H](NC(=O)/C(=C\c1ccc(Br)cc1)NC(=O)c1ccc(Br)o1)C(=O)O |
| InChI | InChI=1S/C19H18Br2N2O5/c1-10(2)16(19(26)27)23-17(24)13(9-11-3-5-12(20)6-4-11)22-18(25)14-7-8-15(21)28-14/h3-10,16H,1-2H3,(H,22,25)(H,23,24)(H,26,27)/b13-9+/t16-/m1/s1 |
| InChIKey | PUZXFVZVCKXPAJ-LRFDDAOPSA-N |
| XLogP | 3.80 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.17 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|