C15H13BrN2O6 — CID 92848509
(2R)-2-[[(Z)-2-[(5-bromofuran-2-carbonyl)amino]-3-(furan-2-yl)prop-2-enoyl]amino]propanoic acid (PubChem CID 92848509) has the molecular formula C15H13BrN2O6 and a molecular weight of 397.18 g/mol. Its IUPAC name is (2R)-2-[[(Z)-2-[(5-bromofuran-2-carbonyl)amino]-3-(furan-2-yl)prop-2-enoyl]amino]propanoic acid.
| Compound Name | (2R)-2-[[(Z)-2-[(5-bromofuran-2-carbonyl)amino]-3-(furan-2-yl)prop-2-enoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 92848509 |
| Molecular Formula | C15H13BrN2O6 |
| Molecular Weight | 397.18 g/mol |
| Exact Mass | 396.00 |
| IUPAC Name | (2R)-2-[[(Z)-2-[(5-bromofuran-2-carbonyl)amino]-3-(furan-2-yl)prop-2-enoyl]amino]propanoic acid |
| SMILES | C[C@@H](NC(=O)/C(=C/c1ccco1)NC(=O)c1ccc(Br)o1)C(=O)O |
| InChI | InChI=1S/C15H13BrN2O6/c1-8(15(21)22)17-13(19)10(7-9-3-2-6-23-9)18-14(20)11-4-5-12(16)24-11/h2-8H,1H3,(H,17,19)(H,18,20)(H,21,22)/b10-7-/t8-/m1/s1 |
| InChIKey | OBYASUABGHEJEI-FBHKUJJOSA-N |
| XLogP | 2.00 |
| TPSA | 121.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.18 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|