C14H9BrNO4- — CID 7375615
(E)-2-[(5-bromofuran-2-carbonyl)amino]-3-phenylprop-2-enoate (PubChem CID 7375615) has the molecular formula C14H9BrNO4- and a molecular weight of 335.13 g/mol. Its IUPAC name is (E)-2-[(5-bromofuran-2-carbonyl)amino]-3-phenylprop-2-enoate.
| Compound Name | (E)-2-[(5-bromofuran-2-carbonyl)amino]-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 7375615 |
| Molecular Formula | C14H9BrNO4- |
| Molecular Weight | 335.13 g/mol |
| Exact Mass | 333.97 |
| IUPAC Name | (E)-2-[(5-bromofuran-2-carbonyl)amino]-3-phenylprop-2-enoate |
| SMILES | O=C([O-])/C(=C\c1ccccc1)NC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C14H10BrNO4/c15-12-7-6-11(20-12)13(17)16-10(14(18)19)8-9-4-2-1-3-5-9/h1-8H,(H,16,17)(H,18,19)/p-1/b10-8+ |
| InChIKey | IYTYESIAKCAKHZ-CSKARUKUSA-M |
| XLogP | 1.56 |
| TPSA | 82.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.13 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|