C25H22BrN3O3 — CID 3913152
5-bromo-N-[3-[2-(2-methyl-1H-indol-3-yl)ethylamino]-3-oxo-1-phenylprop-1-en-2-yl]furan-2-carboxamide (PubChem CID 3913152) has the molecular formula C25H22BrN3O3 and a molecular weight of 492.37 g/mol. Its IUPAC name is 5-bromo-N-[3-[2-(2-methyl-1H-indol-3-yl)ethylamino]-3-oxo-1-phenylprop-1-en-2-yl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[3-[2-(2-methyl-1H-indol-3-yl)ethylamino]-3-oxo-1-phenylprop-1-en-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3913152 |
| Molecular Formula | C25H22BrN3O3 |
| Molecular Weight | 492.37 g/mol |
| Exact Mass | 491.08 |
| IUPAC Name | 5-bromo-N-[3-[2-(2-methyl-1H-indol-3-yl)ethylamino]-3-oxo-1-phenylprop-1-en-2-yl]furan-2-carboxamide |
| SMILES | Cc1[nH]c2ccccc2c1CCNC(=O)C(=Cc1ccccc1)NC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C25H22BrN3O3/c1-16-18(19-9-5-6-10-20(19)28-16)13-14-27-24(30)21(15-17-7-3-2-4-8-17)29-25(31)22-11-12-23(26)32-22/h2-12,15,28H,13-14H2,1H3,(H,27,30)(H,29,31) |
| InChIKey | SYHDSEXCZNBVTR-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 87.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.37 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|