C28H26ClN3O3 — CID 5124363
N-[1-(4-chlorophenyl)-3-[2-(2-methyl-1H-indol-3-yl)ethylamino]-3-oxoprop-1-en-2-yl]-4-methoxybenzamide (PubChem CID 5124363) has the molecular formula C28H26ClN3O3 and a molecular weight of 487.99 g/mol. Its IUPAC name is N-[1-(4-chlorophenyl)-3-[2-(2-methyl-1H-indol-3-yl)ethylamino]-3-oxoprop-1-en-2-yl]-4-methoxybenzamide.
| Compound Name | N-[1-(4-chlorophenyl)-3-[2-(2-methyl-1H-indol-3-yl)ethylamino]-3-oxoprop-1-en-2-yl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 5124363 |
| Molecular Formula | C28H26ClN3O3 |
| Molecular Weight | 487.99 g/mol |
| Exact Mass | 487.17 |
| IUPAC Name | N-[1-(4-chlorophenyl)-3-[2-(2-methyl-1H-indol-3-yl)ethylamino]-3-oxoprop-1-en-2-yl]-4-methoxybenzamide |
| SMILES | COc1ccc(C(=O)NC(=Cc2ccc(Cl)cc2)C(=O)NCCc2c(C)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C28H26ClN3O3/c1-18-23(24-5-3-4-6-25(24)31-18)15-16-30-28(34)26(17-19-7-11-21(29)12-8-19)32-27(33)20-9-13-22(35-2)14-10-20/h3-14,17,31H,15-16H2,1-2H3,(H,30,34)(H,32,33) |
| InChIKey | BMVINCMRYUKIKO-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.99 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|