C31H32ClN3O3 — CID 5165671
4-butoxy-N-[1-(4-chlorophenyl)-3-[2-(2-methyl-1H-indol-3-yl)ethylamino]-3-oxoprop-1-en-2-yl]benzamide (PubChem CID 5165671) has the molecular formula C31H32ClN3O3 and a molecular weight of 530.07 g/mol. Its IUPAC name is 4-butoxy-N-[1-(4-chlorophenyl)-3-[2-(2-methyl-1H-indol-3-yl)ethylamino]-3-oxoprop-1-en-2-yl]benzamide.
| Compound Name | 4-butoxy-N-[1-(4-chlorophenyl)-3-[2-(2-methyl-1H-indol-3-yl)ethylamino]-3-oxoprop-1-en-2-yl]benzamide |
|---|---|
| PubChem CID | 5165671 |
| Molecular Formula | C31H32ClN3O3 |
| Molecular Weight | 530.07 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 4-butoxy-N-[1-(4-chlorophenyl)-3-[2-(2-methyl-1H-indol-3-yl)ethylamino]-3-oxoprop-1-en-2-yl]benzamide |
| SMILES | CCCCOc1ccc(C(=O)NC(=Cc2ccc(Cl)cc2)C(=O)NCCc2c(C)[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C31H32ClN3O3/c1-3-4-19-38-25-15-11-23(12-16-25)30(36)35-29(20-22-9-13-24(32)14-10-22)31(37)33-18-17-26-21(2)34-28-8-6-5-7-27(26)28/h5-16,20,34H,3-4,17-19H2,1-2H3,(H,33,37)(H,35,36) |
| InChIKey | RBESFJUVYJPCPY-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.07 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|