C23H26ClN3O2 — CID 52521357
4-chloro-N-[(2R)-3-methyl-1-[2-(2-methyl-1H-indol-3-yl)ethylamino]-1-oxobutan-2-yl]benzamide (PubChem CID 52521357) has the molecular formula C23H26ClN3O2 and a molecular weight of 411.93 g/mol. Its IUPAC name is 4-chloro-N-[(2R)-3-methyl-1-[2-(2-methyl-1H-indol-3-yl)ethylamino]-1-oxobutan-2-yl]benzamide.
| Compound Name | 4-chloro-N-[(2R)-3-methyl-1-[2-(2-methyl-1H-indol-3-yl)ethylamino]-1-oxobutan-2-yl]benzamide |
|---|---|
| PubChem CID | 52521357 |
| Molecular Formula | C23H26ClN3O2 |
| Molecular Weight | 411.93 g/mol |
| Exact Mass | 411.17 |
| IUPAC Name | 4-chloro-N-[(2R)-3-methyl-1-[2-(2-methyl-1H-indol-3-yl)ethylamino]-1-oxobutan-2-yl]benzamide |
| SMILES | Cc1[nH]c2ccccc2c1CCNC(=O)[C@H](NC(=O)c1ccc(Cl)cc1)C(C)C |
| InChI | InChI=1S/C23H26ClN3O2/c1-14(2)21(27-22(28)16-8-10-17(24)11-9-16)23(29)25-13-12-18-15(3)26-20-7-5-4-6-19(18)20/h4-11,14,21,26H,12-13H2,1-3H3,(H,25,29)(H,27,28)/t21-/m1/s1 |
| InChIKey | KVRDDLZYTIEMKB-OAQYLSRUSA-N |
| XLogP | 4.24 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.93 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|