C21H14BrN3O7 — CID 2270711
3-[[(Z)-2-[(5-bromofuran-2-carbonyl)amino]-3-(3-nitrophenyl)prop-2-enoyl]amino]benzoic acid (PubChem CID 2270711) has the molecular formula C21H14BrN3O7 and a molecular weight of 500.26 g/mol. Its IUPAC name is 3-[[(Z)-2-[(5-bromofuran-2-carbonyl)amino]-3-(3-nitrophenyl)prop-2-enoyl]amino]benzoic acid.
| Compound Name | 3-[[(Z)-2-[(5-bromofuran-2-carbonyl)amino]-3-(3-nitrophenyl)prop-2-enoyl]amino]benzoic acid |
|---|---|
| PubChem CID | 2270711 |
| Molecular Formula | C21H14BrN3O7 |
| Molecular Weight | 500.26 g/mol |
| Exact Mass | 499.00 |
| IUPAC Name | 3-[[(Z)-2-[(5-bromofuran-2-carbonyl)amino]-3-(3-nitrophenyl)prop-2-enoyl]amino]benzoic acid |
| SMILES | O=C(Nc1cccc(C(=O)O)c1)/C(=C/c1cccc([N+](=O)[O-])c1)NC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C21H14BrN3O7/c22-18-8-7-17(32-18)20(27)24-16(10-12-3-1-6-15(9-12)25(30)31)19(26)23-14-5-2-4-13(11-14)21(28)29/h1-11H,(H,23,26)(H,24,27)(H,28,29)/b16-10- |
| InChIKey | WDLFDKGOLPEZQG-YBEGLDIGSA-N |
| XLogP | 4.06 |
| TPSA | 151.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.26 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|