C24H17BrN2O3 — CID 3126160
5-bromo-N-[3-(naphthalen-2-ylamino)-3-oxo-1-phenylprop-1-en-2-yl]furan-2-carboxamide (PubChem CID 3126160) has the molecular formula C24H17BrN2O3 and a molecular weight of 461.32 g/mol. Its IUPAC name is 5-bromo-N-[3-(naphthalen-2-ylamino)-3-oxo-1-phenylprop-1-en-2-yl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[3-(naphthalen-2-ylamino)-3-oxo-1-phenylprop-1-en-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3126160 |
| Molecular Formula | C24H17BrN2O3 |
| Molecular Weight | 461.32 g/mol |
| Exact Mass | 460.04 |
| IUPAC Name | 5-bromo-N-[3-(naphthalen-2-ylamino)-3-oxo-1-phenylprop-1-en-2-yl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc2ccccc2c1)C(=Cc1ccccc1)NC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C24H17BrN2O3/c25-22-13-12-21(30-22)24(29)27-20(14-16-6-2-1-3-7-16)23(28)26-19-11-10-17-8-4-5-9-18(17)15-19/h1-15H,(H,26,28)(H,27,29) |
| InChIKey | JBOMWUYFLAQTND-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.32 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|