C16H12BrNO4 — CID 1293136
2-[(5-bromofuran-2-carbonyl)amino]-5-phenylpenta-2,4-dienoic acid (PubChem CID 1293136) has the molecular formula C16H12BrNO4 and a molecular weight of 362.18 g/mol. Its IUPAC name is 2-[(5-bromofuran-2-carbonyl)amino]-5-phenylpenta-2,4-dienoic acid.
| Compound Name | 2-[(5-bromofuran-2-carbonyl)amino]-5-phenylpenta-2,4-dienoic acid |
|---|---|
| PubChem CID | 1293136 |
| Molecular Formula | C16H12BrNO4 |
| Molecular Weight | 362.18 g/mol |
| Exact Mass | 360.99 |
| IUPAC Name | 2-[(5-bromofuran-2-carbonyl)amino]-5-phenylpenta-2,4-dienoic acid |
| SMILES | O=C(O)C(=CC=Cc1ccccc1)NC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C16H12BrNO4/c17-14-10-9-13(22-14)15(19)18-12(16(20)21)8-4-7-11-5-2-1-3-6-11/h1-10H,(H,18,19)(H,20,21) |
| InChIKey | FAJURQBOZOKKAD-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.18 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|