C20H17NO3 — CID 155299093
(2Z,4E)-5-phenyl-2-(3-phenylprop-2-enoylamino)penta-2,4-dienoic acid (PubChem CID 155299093) has the molecular formula C20H17NO3 and a molecular weight of 319.36 g/mol. Its IUPAC name is (2Z,4E)-5-phenyl-2-(3-phenylprop-2-enoylamino)penta-2,4-dienoic acid.
| Compound Name | (2Z,4E)-5-phenyl-2-(3-phenylprop-2-enoylamino)penta-2,4-dienoic acid |
|---|---|
| PubChem CID | 155299093 |
| Molecular Formula | C20H17NO3 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.12 |
| IUPAC Name | (2Z,4E)-5-phenyl-2-(3-phenylprop-2-enoylamino)penta-2,4-dienoic acid |
| SMILES | O=C(C=Cc1ccccc1)N/C(=C\C=C\c1ccccc1)C(=O)O |
| InChI | InChI=1S/C20H17NO3/c22-19(15-14-17-10-5-2-6-11-17)21-18(20(23)24)13-7-12-16-8-3-1-4-9-16/h1-15H,(H,21,22)(H,23,24)/b12-7+,15-14?,18-13- |
| InChIKey | MXZRKWWSGYCLIP-OZPOLZRMSA-N |
| XLogP | 3.50 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|