C21H20N2O2 — CID 155299076
(2Z,4E)-N-methyl-5-phenyl-2-[[(E)-3-phenylprop-2-enoyl]amino]penta-2,4-dienamide (PubChem CID 155299076) has the molecular formula C21H20N2O2 and a molecular weight of 332.40 g/mol. Its IUPAC name is (2Z,4E)-N-methyl-5-phenyl-2-[[(E)-3-phenylprop-2-enoyl]amino]penta-2,4-dienamide.
| Compound Name | (2Z,4E)-N-methyl-5-phenyl-2-[[(E)-3-phenylprop-2-enoyl]amino]penta-2,4-dienamide |
|---|---|
| PubChem CID | 155299076 |
| Molecular Formula | C21H20N2O2 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.15 |
| IUPAC Name | (2Z,4E)-N-methyl-5-phenyl-2-[[(E)-3-phenylprop-2-enoyl]amino]penta-2,4-dienamide |
| SMILES | CNC(=O)/C(=C/C=C/c1ccccc1)NC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C21H20N2O2/c1-22-21(25)19(14-8-13-17-9-4-2-5-10-17)23-20(24)16-15-18-11-6-3-7-12-18/h2-16H,1H3,(H,22,25)(H,23,24)/b13-8+,16-15+,19-14- |
| InChIKey | ABICNYNOTYXXPP-VZXUCIHMSA-N |
| XLogP | 3.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|