C24H23N3O2 — CID 155297575
(Z)-N-[(2E,4Z)-5-(methylideneamino)penta-2,4-dien-2-yl]-3-phenyl-2-[[(E)-3-phenylprop-2-enoyl]amino]prop-2-enamide (PubChem CID 155297575) has the molecular formula C24H23N3O2 and a molecular weight of 385.47 g/mol. Its IUPAC name is (Z)-N-[(2E,4Z)-5-(methylideneamino)penta-2,4-dien-2-yl]-3-phenyl-2-[[(E)-3-phenylprop-2-enoyl]amino]prop-2-enamide.
| Compound Name | (Z)-N-[(2E,4Z)-5-(methylideneamino)penta-2,4-dien-2-yl]-3-phenyl-2-[[(E)-3-phenylprop-2-enoyl]amino]prop-2-enamide |
|---|---|
| PubChem CID | 155297575 |
| Molecular Formula | C24H23N3O2 |
| Molecular Weight | 385.47 g/mol |
| Exact Mass | 385.18 |
| IUPAC Name | (Z)-N-[(2E,4Z)-5-(methylideneamino)penta-2,4-dien-2-yl]-3-phenyl-2-[[(E)-3-phenylprop-2-enoyl]amino]prop-2-enamide |
| SMILES | C=N/C=C\C=C(/C)NC(=O)/C(=C/c1ccccc1)NC(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C24H23N3O2/c1-19(10-9-17-25-2)26-24(29)22(18-21-13-7-4-8-14-21)27-23(28)16-15-20-11-5-3-6-12-20/h3-18H,2H2,1H3,(H,26,29)(H,27,28)/b16-15+,17-9-,19-10+,22-18- |
| InChIKey | NMFRLWXYIGFXFS-WHLNACEWSA-N |
| XLogP | 4.09 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|