C18H15BrN2O2 — CID 6512518
N-[(2E,4E)-1-amino-1-oxo-5-phenylpenta-2,4-dien-2-yl]-2-bromobenzamide (PubChem CID 6512518) has the molecular formula C18H15BrN2O2 and a molecular weight of 371.23 g/mol. Its IUPAC name is N-[(2E,4E)-1-amino-1-oxo-5-phenylpenta-2,4-dien-2-yl]-2-bromobenzamide.
| Compound Name | N-[(2E,4E)-1-amino-1-oxo-5-phenylpenta-2,4-dien-2-yl]-2-bromobenzamide |
|---|---|
| PubChem CID | 6512518 |
| Molecular Formula | C18H15BrN2O2 |
| Molecular Weight | 371.23 g/mol |
| Exact Mass | 370.03 |
| IUPAC Name | N-[(2E,4E)-1-amino-1-oxo-5-phenylpenta-2,4-dien-2-yl]-2-bromobenzamide |
| SMILES | NC(=O)/C(=C\C=C\c1ccccc1)NC(=O)c1ccccc1Br |
| InChI | InChI=1S/C18H15BrN2O2/c19-15-11-5-4-10-14(15)18(23)21-16(17(20)22)12-6-9-13-7-2-1-3-8-13/h1-12H,(H2,20,22)(H,21,23)/b9-6+,16-12+ |
| InChIKey | RDCAPRLOGQPOEP-LVEAOLTQSA-N |
| XLogP | 3.26 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.23 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|