C17H24NO4- — CID 145137506
10-[(2-hydroxybenzoyl)amino]decanoate (PubChem CID 145137506) has the molecular formula C17H24NO4- and a molecular weight of 306.38 g/mol. Its IUPAC name is 10-[(2-hydroxybenzoyl)amino]decanoate.
| Compound Name | 10-[(2-hydroxybenzoyl)amino]decanoate |
|---|---|
| PubChem CID | 145137506 |
| Molecular Formula | C17H24NO4- |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | 10-[(2-hydroxybenzoyl)amino]decanoate |
| SMILES | O=C([O-])CCCCCCCCCNC(=O)c1ccccc1O |
| InChI | InChI=1S/C17H25NO4/c19-15-11-8-7-10-14(15)17(22)18-13-9-5-3-1-2-4-6-12-16(20)21/h7-8,10-11,19H,1-6,9,12-13H2,(H,18,22)(H,20,21)/p-1 |
| InChIKey | XUVPEOCUEJAFCI-UHFFFAOYSA-M |
| XLogP | 1.99 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|