C19H30N2O6 — CID 175912578
2-(dimethylamino)acetic acid;8-[(2-hydroxybenzoyl)amino]octanoic acid (PubChem CID 175912578) has the molecular formula C19H30N2O6 and a molecular weight of 382.46 g/mol. Its IUPAC name is 2-(dimethylamino)acetic acid;8-[(2-hydroxybenzoyl)amino]octanoic acid.
| Compound Name | 2-(dimethylamino)acetic acid;8-[(2-hydroxybenzoyl)amino]octanoic acid |
|---|---|
| PubChem CID | 175912578 |
| Molecular Formula | C19H30N2O6 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | 2-(dimethylamino)acetic acid;8-[(2-hydroxybenzoyl)amino]octanoic acid |
| SMILES | CN(C)CC(=O)O.O=C(O)CCCCCCCNC(=O)c1ccccc1O |
| InChI | InChI=1S/C15H21NO4.C4H9NO2/c17-13-9-6-5-8-12(13)15(20)16-11-7-3-1-2-4-10-14(18)19;1-5(2)3-4(6)7/h5-6,8-9,17H,1-4,7,10-11H2,(H,16,20)(H,18,19);3H2,1-2H3,(H,6,7) |
| InChIKey | FGFQRJZVEAPDLT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|