C19H29ClN2O6 — CID 175912577
8-[(5-chloro-2-hydroxybenzoyl)amino]octanoic acid;2-(dimethylamino)acetic acid (PubChem CID 175912577) has the molecular formula C19H29ClN2O6 and a molecular weight of 416.90 g/mol. Its IUPAC name is 8-[(5-chloro-2-hydroxybenzoyl)amino]octanoic acid;2-(dimethylamino)acetic acid.
| Compound Name | 8-[(5-chloro-2-hydroxybenzoyl)amino]octanoic acid;2-(dimethylamino)acetic acid |
|---|---|
| PubChem CID | 175912577 |
| Molecular Formula | C19H29ClN2O6 |
| Molecular Weight | 416.90 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 8-[(5-chloro-2-hydroxybenzoyl)amino]octanoic acid;2-(dimethylamino)acetic acid |
| SMILES | CN(C)CC(=O)O.O=C(O)CCCCCCCNC(=O)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C15H20ClNO4.C4H9NO2/c16-11-7-8-13(18)12(10-11)15(21)17-9-5-3-1-2-4-6-14(19)20;1-5(2)3-4(6)7/h7-8,10,18H,1-6,9H2,(H,17,21)(H,19,20);3H2,1-2H3,(H,6,7) |
| InChIKey | KIFLWRKTOFZFCE-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 127.17 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.90 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|