C17H24ClNO4 — CID 126640594
8-[(5-chloro-2-hydroxybenzoyl)amino]decanoic acid (PubChem CID 126640594) has the molecular formula C17H24ClNO4 and a molecular weight of 341.83 g/mol. Its IUPAC name is 8-[(5-chloro-2-hydroxybenzoyl)amino]decanoic acid.
| Compound Name | 8-[(5-chloro-2-hydroxybenzoyl)amino]decanoic acid |
|---|---|
| PubChem CID | 126640594 |
| Molecular Formula | C17H24ClNO4 |
| Molecular Weight | 341.83 g/mol |
| Exact Mass | 341.14 |
| IUPAC Name | 8-[(5-chloro-2-hydroxybenzoyl)amino]decanoic acid |
| SMILES | CCC(CCCCCCC(=O)O)NC(=O)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C17H24ClNO4/c1-2-13(7-5-3-4-6-8-16(21)22)19-17(23)14-11-12(18)9-10-15(14)20/h9-11,13,20H,2-8H2,1H3,(H,19,23)(H,21,22) |
| InChIKey | GLMOAHUQKRCRNH-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.83 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|