C20H32ClN3O4 — CID 175439184
8-[(5-chloro-2-hydroxybenzoyl)amino]octanoic acid;1-methylpiperazine (PubChem CID 175439184) has the molecular formula C20H32ClN3O4 and a molecular weight of 413.95 g/mol. Its IUPAC name is 8-[(5-chloro-2-hydroxybenzoyl)amino]octanoic acid;1-methylpiperazine.
| Compound Name | 8-[(5-chloro-2-hydroxybenzoyl)amino]octanoic acid;1-methylpiperazine |
|---|---|
| PubChem CID | 175439184 |
| Molecular Formula | C20H32ClN3O4 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.21 |
| IUPAC Name | 8-[(5-chloro-2-hydroxybenzoyl)amino]octanoic acid;1-methylpiperazine |
| SMILES | CN1CCNCC1.O=C(O)CCCCCCCNC(=O)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C15H20ClNO4.C5H12N2/c16-11-7-8-13(18)12(10-11)15(21)17-9-5-3-1-2-4-6-14(19)20;1-7-4-2-6-3-5-7/h7-8,10,18H,1-6,9H2,(H,17,21)(H,19,20);6H,2-5H2,1H3 |
| InChIKey | ZGHYMWTVIOFGQT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 101.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|