C10H11BrClNO2 — CID 114307431
N-(3-bromopropyl)-5-chloro-2-hydroxybenzamide (PubChem CID 114307431) has the molecular formula C10H11BrClNO2 and a molecular weight of 292.56 g/mol. Its IUPAC name is N-(3-bromopropyl)-5-chloro-2-hydroxybenzamide.
| Compound Name | N-(3-bromopropyl)-5-chloro-2-hydroxybenzamide |
|---|---|
| PubChem CID | 114307431 |
| Molecular Formula | C10H11BrClNO2 |
| Molecular Weight | 292.56 g/mol |
| Exact Mass | 290.97 |
| IUPAC Name | N-(3-bromopropyl)-5-chloro-2-hydroxybenzamide |
| SMILES | O=C(NCCCBr)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C10H11BrClNO2/c11-4-1-5-13-10(15)8-6-7(12)2-3-9(8)14/h2-3,6,14H,1,4-5H2,(H,13,15) |
| InChIKey | UNQHIZNTARXMLF-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.56 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|