C25H35ClN2O4 — CID 169085802
benzyl(trimethyl)azanium;8-[(5-chloro-2-hydroxybenzoyl)amino]octanoate (PubChem CID 169085802) has the molecular formula C25H35ClN2O4 and a molecular weight of 463.02 g/mol. Its IUPAC name is benzyl(trimethyl)azanium;8-[(5-chloro-2-hydroxybenzoyl)amino]octanoate.
| Compound Name | benzyl(trimethyl)azanium;8-[(5-chloro-2-hydroxybenzoyl)amino]octanoate |
|---|---|
| PubChem CID | 169085802 |
| Molecular Formula | C25H35ClN2O4 |
| Molecular Weight | 463.02 g/mol |
| Exact Mass | 462.23 |
| IUPAC Name | benzyl(trimethyl)azanium;8-[(5-chloro-2-hydroxybenzoyl)amino]octanoate |
| SMILES | C[N+](C)(C)Cc1ccccc1.O=C([O-])CCCCCCCNC(=O)c1cc(Cl)ccc1O |
| InChI | InChI=1S/C15H20ClNO4.C10H16N/c16-11-7-8-13(18)12(10-11)15(21)17-9-5-3-1-2-4-6-14(19)20;1-11(2,3)9-10-7-5-4-6-8-10/h7-8,10,18H,1-6,9H2,(H,17,21)(H,19,20);4-8H,9H2,1-3H3/q;+1/p-1 |
| InChIKey | OHDDRDZMIOTAJK-UHFFFAOYSA-M |
| XLogP | 3.76 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.02 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|