C17H15ClNNaO4 — CID 25217040
sodium 4-[4-[(5-chloro-2-hydroxybenzoyl)amino]phenyl]butanoate (PubChem CID 25217040) has the molecular formula C17H15ClNNaO4 and a molecular weight of 355.75 g/mol. Its IUPAC name is sodium 4-[4-[(5-chloro-2-hydroxybenzoyl)amino]phenyl]butanoate.
| Compound Name | sodium 4-[4-[(5-chloro-2-hydroxybenzoyl)amino]phenyl]butanoate |
|---|---|
| PubChem CID | 25217040 |
| Molecular Formula | C17H15ClNNaO4 |
| Molecular Weight | 355.75 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | sodium 4-[4-[(5-chloro-2-hydroxybenzoyl)amino]phenyl]butanoate |
| SMILES | O=C([O-])CCCc1ccc(NC(=O)c2cc(Cl)ccc2O)cc1.[Na+] |
| InChI | InChI=1S/C17H16ClNO4.Na/c18-12-6-9-15(20)14(10-12)17(23)19-13-7-4-11(5-8-13)2-1-3-16(21)22;/h4-10,20H,1-3H2,(H,19,23)(H,21,22);/q;+1/p-1 |
| InChIKey | UGNDSTZBMMBIOP-UHFFFAOYSA-M |
| XLogP | -0.63 |
| TPSA | 89.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.75 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |