4-[4-[(2,5-dichlorobenzoyl)amino]phenyl]butanoic acid

C17H15Cl2NO3 — CID 21037055

IUPAC4-[4-[(2,5-dichlorobenzoyl)amino]phenyl]butanoic acid
SMILESO=C(O)CCCc1ccc(NC(=O)c2cc(Cl)ccc2Cl)cc1
InChIInChI=1S/C17H15Cl2NO3/c18-12-6-9-15(19)14(10-12)17(23)20-13-7-4-11(5-8-13)2-1-3-16(21)22/h4-10H,1-3H2,(H,20,23)(H,21,22)
InChIKeyTXBSNCOXXISGEB-UHFFFAOYSA-N
MW352.22 g/mol
LogP4.65
Rot. Bonds6

About 4-[4-[(2,5-dichlorobenzoyl)amino]phenyl]butanoic acid

4-[4-[(2,5-dichlorobenzoyl)amino]phenyl]butanoic acid (PubChem CID 21037055) has the molecular formula C17H15Cl2NO3 and a molecular weight of 352.22 g/mol. Its IUPAC name is 4-[4-[(2,5-dichlorobenzoyl)amino]phenyl]butanoic acid.

Molecular Properties

Compound Name4-[4-[(2,5-dichlorobenzoyl)amino]phenyl]butanoic acid
PubChem CID21037055
Molecular FormulaC17H15Cl2NO3
Molecular Weight352.22 g/mol
Exact Mass351.04
IUPAC Name4-[4-[(2,5-dichlorobenzoyl)amino]phenyl]butanoic acid
SMILESO=C(O)CCCc1ccc(NC(=O)c2cc(Cl)ccc2Cl)cc1
InChIInChI=1S/C17H15Cl2NO3/c18-12-6-9-15(19)14(10-12)17(23)20-13-7-4-11(5-8-13)2-1-3-16(21)22/h4-10H,1-3H2,(H,20,23)(H,21,22)
InChIKeyTXBSNCOXXISGEB-UHFFFAOYSA-N
XLogP4.65
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms23
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500352.22
LogP ≤ 54.65
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-[4-[(2,5-dichlorobenzoyl)amino]phenyl]butanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-[4-[(2,5-dichlorobenzoyl)amino]phenyl]butanoic acid?
The IUPAC name of 4-[4-[(2,5-dichlorobenzoyl)amino]phenyl]butanoic acid (CID 21037055) is 4-[4-[(2,5-dichlorobenzoyl)amino]phenyl]butanoic acid.
What is the SMILES notation for 4-[4-[(2,5-dichlorobenzoyl)amino]phenyl]butanoic acid?
The canonical SMILES for 4-[4-[(2,5-dichlorobenzoyl)amino]phenyl]butanoic acid is O=C(O)CCCc1ccc(NC(=O)c2cc(Cl)ccc2Cl)cc1.
What is the InChIKey of 4-[4-[(2,5-dichlorobenzoyl)amino]phenyl]butanoic acid?
The InChIKey is TXBSNCOXXISGEB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H15Cl2NO3/c18-12-6-9-15(19)14(10-12)17(23)20-13-7-4-11(5-8-13)2-1-3-16(21)22/h4-10H,1-3H2,(H,20,23)(H,21,22).
What are the key properties of 4-[4-[(2,5-dichlorobenzoyl)amino]phenyl]butanoic acid?
4-[4-[(2,5-dichlorobenzoyl)amino]phenyl]butanoic acid has a molecular weight of 352.22 g/mol, XLogP of 4.65, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[(2,5-dichlorobenzoyl)amino]phenyl]butanoic acid is sourced from PubChem (CID 21037055), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).