C15H21N3O4S — CID 8669515
methyl 6-[[(2-hydroxybenzoyl)amino]carbamothioylamino]hexanoate (PubChem CID 8669515) has the molecular formula C15H21N3O4S and a molecular weight of 339.42 g/mol. Its IUPAC name is methyl 6-[[(2-hydroxybenzoyl)amino]carbamothioylamino]hexanoate.
| Compound Name | methyl 6-[[(2-hydroxybenzoyl)amino]carbamothioylamino]hexanoate |
|---|---|
| PubChem CID | 8669515 |
| Molecular Formula | C15H21N3O4S |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | methyl 6-[[(2-hydroxybenzoyl)amino]carbamothioylamino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=S)NNC(=O)c1ccccc1O |
| InChI | InChI=1S/C15H21N3O4S/c1-22-13(20)9-3-2-6-10-16-15(23)18-17-14(21)11-7-4-5-8-12(11)19/h4-5,7-8,19H,2-3,6,9-10H2,1H3,(H,17,21)(H2,16,18,23) |
| InChIKey | NHLFZQHOOLDLLZ-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 99.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|