C31H46F4N2O7 — CID 86613077
tert-butyl 3-[11-[(2-methylpropan-2-yl)oxycarbonylamino]undecanoylamino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate (PubChem CID 86613077) has the molecular formula C31H46F4N2O7 and a molecular weight of 634.71 g/mol. Its IUPAC name is tert-butyl 3-[11-[(2-methylpropan-2-yl)oxycarbonylamino]undecanoylamino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate.
| Compound Name | tert-butyl 3-[11-[(2-methylpropan-2-yl)oxycarbonylamino]undecanoylamino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
|---|---|
| PubChem CID | 86613077 |
| Molecular Formula | C31H46F4N2O7 |
| Molecular Weight | 634.71 g/mol |
| Exact Mass | 634.32 |
| IUPAC Name | tert-butyl 3-[11-[(2-methylpropan-2-yl)oxycarbonylamino]undecanoylamino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
| SMILES | CC(C)(C)OC(=O)CC(NC(=O)CCCCCCCCCCNC(=O)OC(C)(C)C)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C31H46F4N2O7/c1-30(2,3)43-25(40)18-22(23(38)19-42-28-26(34)20(32)17-21(33)27(28)35)37-24(39)15-13-11-9-7-8-10-12-14-16-36-29(41)44-31(4,5)6/h17,22H,7-16,18-19H2,1-6H3,(H,36,41)(H,37,39) |
| InChIKey | YQOYIZCEWLPFHT-UHFFFAOYSA-N |
| XLogP | 6.44 |
| TPSA | 120.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.71 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|