C31H35F4N3O6 — CID 86756370
tert-butyl 3-[[(2S)-2-[(1,3-dimethylindole-2-carbonyl)amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate (PubChem CID 86756370) has the molecular formula C31H35F4N3O6 and a molecular weight of 621.63 g/mol. Its IUPAC name is tert-butyl 3-[[(2S)-2-[(1,3-dimethylindole-2-carbonyl)amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate.
| Compound Name | tert-butyl 3-[[(2S)-2-[(1,3-dimethylindole-2-carbonyl)amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
|---|---|
| PubChem CID | 86756370 |
| Molecular Formula | C31H35F4N3O6 |
| Molecular Weight | 621.63 g/mol |
| Exact Mass | 621.25 |
| IUPAC Name | tert-butyl 3-[[(2S)-2-[(1,3-dimethylindole-2-carbonyl)amino]-3-methylbutanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoate |
| SMILES | Cc1c(C(=O)N[C@H](C(=O)NC(CC(=O)OC(C)(C)C)C(=O)COc2c(F)c(F)cc(F)c2F)C(C)C)n(C)c2ccccc12 |
| InChI | InChI=1S/C31H35F4N3O6/c1-15(2)26(37-30(42)27-16(3)17-10-8-9-11-21(17)38(27)7)29(41)36-20(13-23(40)44-31(4,5)6)22(39)14-43-28-24(34)18(32)12-19(33)25(28)35/h8-12,15,20,26H,13-14H2,1-7H3,(H,36,41)(H,37,42)/t20?,26-/m0/s1 |
| InChIKey | SCTDGLTXHDGVAS-GHZUAHJPSA-N |
| XLogP | 4.66 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.63 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|