C25H22F7N3O7 — CID 10232587
(3S)-3-[[(2S)-3-methyl-2-[[2-oxo-2-[2-(trifluoromethyl)anilino]acetyl]amino]butanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid (PubChem CID 10232587) has the molecular formula C25H22F7N3O7 and a molecular weight of 609.45 g/mol. Its IUPAC name is (3S)-3-[[(2S)-3-methyl-2-[[2-oxo-2-[2-(trifluoromethyl)anilino]acetyl]amino]butanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid.
| Compound Name | (3S)-3-[[(2S)-3-methyl-2-[[2-oxo-2-[2-(trifluoromethyl)anilino]acetyl]amino]butanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
|---|---|
| PubChem CID | 10232587 |
| Molecular Formula | C25H22F7N3O7 |
| Molecular Weight | 609.45 g/mol |
| Exact Mass | 609.13 |
| IUPAC Name | (3S)-3-[[(2S)-3-methyl-2-[[2-oxo-2-[2-(trifluoromethyl)anilino]acetyl]amino]butanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
| SMILES | CC(C)[C@H](NC(=O)C(=O)Nc1ccccc1C(F)(F)F)C(=O)N[C@@H](CC(=O)O)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C25H22F7N3O7/c1-10(2)20(35-24(41)23(40)33-14-6-4-3-5-11(14)25(30,31)32)22(39)34-15(8-17(37)38)16(36)9-42-21-18(28)12(26)7-13(27)19(21)29/h3-7,10,15,20H,8-9H2,1-2H3,(H,33,40)(H,34,39)(H,35,41)(H,37,38)/t15-,20-/m0/s1 |
| InChIKey | AWSNOGJUHYLCCA-YWZLYKJASA-N |
| XLogP | 2.95 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|