C26H22F4N4O7 — CID 11512588
(3S)-4-oxo-3-[[(2S)-2-[[2-oxo-2-[2-(1H-pyrrol-2-yl)anilino]acetyl]amino]propanoyl]amino]-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid (PubChem CID 11512588) has the molecular formula C26H22F4N4O7 and a molecular weight of 578.48 g/mol. Its IUPAC name is (3S)-4-oxo-3-[[(2S)-2-[[2-oxo-2-[2-(1H-pyrrol-2-yl)anilino]acetyl]amino]propanoyl]amino]-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid.
| Compound Name | (3S)-4-oxo-3-[[(2S)-2-[[2-oxo-2-[2-(1H-pyrrol-2-yl)anilino]acetyl]amino]propanoyl]amino]-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
|---|---|
| PubChem CID | 11512588 |
| Molecular Formula | C26H22F4N4O7 |
| Molecular Weight | 578.48 g/mol |
| Exact Mass | 578.14 |
| IUPAC Name | (3S)-4-oxo-3-[[(2S)-2-[[2-oxo-2-[2-(1H-pyrrol-2-yl)anilino]acetyl]amino]propanoyl]amino]-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
| SMILES | C[C@H](NC(=O)C(=O)Nc1ccccc1-c1ccc[nH]1)C(=O)N[C@@H](CC(=O)O)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C26H22F4N4O7/c1-12(32-25(39)26(40)33-17-6-3-2-5-13(17)16-7-4-8-31-16)24(38)34-18(10-20(36)37)19(35)11-41-23-21(29)14(27)9-15(28)22(23)30/h2-9,12,18,31H,10-11H2,1H3,(H,32,39)(H,33,40)(H,34,38)(H,36,37)/t12-,18-/m0/s1 |
| InChIKey | HCJYZSJEOAHRPG-SGTLLEGYSA-N |
| XLogP | 2.29 |
| TPSA | 166.69 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.48 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|