C23H19F5N2O7 — CID 157266240
(3S)-3-[[(2R)-5-(2-fluoroanilino)-2-methyl-4,5-dioxopentanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid (PubChem CID 157266240) has the molecular formula C23H19F5N2O7 and a molecular weight of 530.40 g/mol. Its IUPAC name is (3S)-3-[[(2R)-5-(2-fluoroanilino)-2-methyl-4,5-dioxopentanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid.
| Compound Name | (3S)-3-[[(2R)-5-(2-fluoroanilino)-2-methyl-4,5-dioxopentanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
|---|---|
| PubChem CID | 157266240 |
| Molecular Formula | C23H19F5N2O7 |
| Molecular Weight | 530.40 g/mol |
| Exact Mass | 530.11 |
| IUPAC Name | (3S)-3-[[(2R)-5-(2-fluoroanilino)-2-methyl-4,5-dioxopentanoyl]amino]-4-oxo-5-(2,3,5,6-tetrafluorophenoxy)pentanoic acid |
| SMILES | C[C@H](CC(=O)C(=O)Nc1ccccc1F)C(=O)N[C@@H](CC(=O)O)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C23H19F5N2O7/c1-10(6-16(31)23(36)29-14-5-3-2-4-11(14)24)22(35)30-15(8-18(33)34)17(32)9-37-21-19(27)12(25)7-13(26)20(21)28/h2-5,7,10,15H,6,8-9H2,1H3,(H,29,36)(H,30,35)(H,33,34)/t10-,15+/m1/s1 |
| InChIKey | ZKKPMCCSYWWYQO-BMIGLBTASA-N |
| XLogP | 2.52 |
| TPSA | 138.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|