C27H26F5N5O5 — CID 166170386
N-(2-fluorophenyl)-N'-[(2S)-1-[[(2R)-1-(1H-imidazol-5-yl)-3-oxo-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]oxamide (PubChem CID 166170386) has the molecular formula C27H26F5N5O5 and a molecular weight of 595.53 g/mol. Its IUPAC name is N-(2-fluorophenyl)-N'-[(2S)-1-[[(2R)-1-(1H-imidazol-5-yl)-3-oxo-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]oxamide.
| Compound Name | N-(2-fluorophenyl)-N'-[(2S)-1-[[(2R)-1-(1H-imidazol-5-yl)-3-oxo-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]oxamide |
|---|---|
| PubChem CID | 166170386 |
| Molecular Formula | C27H26F5N5O5 |
| Molecular Weight | 595.53 g/mol |
| Exact Mass | 595.19 |
| IUPAC Name | N-(2-fluorophenyl)-N'-[(2S)-1-[[(2R)-1-(1H-imidazol-5-yl)-3-oxo-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]amino]-4-methyl-1-oxopentan-2-yl]oxamide |
| SMILES | CC(C)C[C@H](NC(=O)C(=O)Nc1ccccc1F)C(=O)N[C@H](Cc1cnc[nH]1)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C27H26F5N5O5/c1-13(2)7-20(37-27(41)26(40)35-18-6-4-3-5-15(18)28)25(39)36-19(8-14-10-33-12-34-14)21(38)11-42-24-22(31)16(29)9-17(30)23(24)32/h3-6,9-10,12-13,19-20H,7-8,11H2,1-2H3,(H,33,34)(H,35,40)(H,36,39)(H,37,41)/t19-,20+/m1/s1 |
| InChIKey | AHVOMXFXZKCSNB-UXHICEINSA-N |
| XLogP | 2.95 |
| TPSA | 142.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.53 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|