C28H28F6N4O6 — CID 166170094
N-(2,6-difluorophenyl)-N'-[(2S)-4-methyl-1-oxo-1-[[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]amino]pentan-2-yl]oxamide (PubChem CID 166170094) has the molecular formula C28H28F6N4O6 and a molecular weight of 630.54 g/mol. Its IUPAC name is N-(2,6-difluorophenyl)-N'-[(2S)-4-methyl-1-oxo-1-[[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]amino]pentan-2-yl]oxamide.
| Compound Name | N-(2,6-difluorophenyl)-N'-[(2S)-4-methyl-1-oxo-1-[[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]amino]pentan-2-yl]oxamide |
|---|---|
| PubChem CID | 166170094 |
| Molecular Formula | C28H28F6N4O6 |
| Molecular Weight | 630.54 g/mol |
| Exact Mass | 630.19 |
| IUPAC Name | N-(2,6-difluorophenyl)-N'-[(2S)-4-methyl-1-oxo-1-[[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]amino]pentan-2-yl]oxamide |
| SMILES | CC(C)C[C@H](NC(=O)C(=O)Nc1c(F)cccc1F)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C28H28F6N4O6/c1-12(2)8-19(37-27(42)28(43)38-23-14(29)4-3-5-15(23)30)26(41)36-18(9-13-6-7-35-25(13)40)20(39)11-44-24-21(33)16(31)10-17(32)22(24)34/h3-5,10,12-13,18-19H,6-9,11H2,1-2H3,(H,35,40)(H,36,41)(H,37,42)(H,38,43)/t13-,18-,19-/m0/s1 |
| InChIKey | DYWDSATZEAFPQX-AGRHKRQWSA-N |
| XLogP | 2.65 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.54 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|