C31H33ClF4N4O6 — CID 166170714
N-(2-chlorophenyl)-N'-[(2S)-3-cyclohexyl-1-oxo-1-[[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]amino]propan-2-yl]oxamide (PubChem CID 166170714) has the molecular formula C31H33ClF4N4O6 and a molecular weight of 669.07 g/mol. Its IUPAC name is N-(2-chlorophenyl)-N'-[(2S)-3-cyclohexyl-1-oxo-1-[[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]amino]propan-2-yl]oxamide.
| Compound Name | N-(2-chlorophenyl)-N'-[(2S)-3-cyclohexyl-1-oxo-1-[[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]amino]propan-2-yl]oxamide |
|---|---|
| PubChem CID | 166170714 |
| Molecular Formula | C31H33ClF4N4O6 |
| Molecular Weight | 669.07 g/mol |
| Exact Mass | 668.20 |
| IUPAC Name | N-(2-chlorophenyl)-N'-[(2S)-3-cyclohexyl-1-oxo-1-[[(2S)-3-oxo-1-[(3S)-2-oxopyrrolidin-3-yl]-4-(2,3,5,6-tetrafluorophenoxy)butan-2-yl]amino]propan-2-yl]oxamide |
| SMILES | O=C(Nc1ccccc1Cl)C(=O)N[C@@H](CC1CCCCC1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)COc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C31H33ClF4N4O6/c32-18-8-4-5-9-21(18)38-30(44)31(45)40-23(12-16-6-2-1-3-7-16)29(43)39-22(13-17-10-11-37-28(17)42)24(41)15-46-27-25(35)19(33)14-20(34)26(27)36/h4-5,8-9,14,16-17,22-23H,1-3,6-7,10-13,15H2,(H,37,42)(H,38,44)(H,39,43)(H,40,45)/t17-,22-,23-/m0/s1 |
| InChIKey | LNTIYOVLMZWSQO-RTFZILSDSA-N |
| XLogP | 3.95 |
| TPSA | 142.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.07 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|