C24H31FN4O5 — CID 166537837
N'-[(2S)-3-cyclohexyl-1-oxo-1-[[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]amino]propan-2-yl]-N-(2-fluorophenyl)oxamide (PubChem CID 166537837) has the molecular formula C24H31FN4O5 and a molecular weight of 474.53 g/mol. Its IUPAC name is N'-[(2S)-3-cyclohexyl-1-oxo-1-[[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]amino]propan-2-yl]-N-(2-fluorophenyl)oxamide.
| Compound Name | N'-[(2S)-3-cyclohexyl-1-oxo-1-[[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]amino]propan-2-yl]-N-(2-fluorophenyl)oxamide |
|---|---|
| PubChem CID | 166537837 |
| Molecular Formula | C24H31FN4O5 |
| Molecular Weight | 474.53 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | N'-[(2S)-3-cyclohexyl-1-oxo-1-[[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]amino]propan-2-yl]-N-(2-fluorophenyl)oxamide |
| SMILES | O=C[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC1CCCCC1)NC(=O)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C24H31FN4O5/c25-18-8-4-5-9-19(18)28-23(33)24(34)29-20(12-15-6-2-1-3-7-15)22(32)27-17(14-30)13-16-10-11-26-21(16)31/h4-5,8-9,14-17,20H,1-3,6-7,10-13H2,(H,26,31)(H,27,32)(H,28,33)(H,29,34)/t16-,17-,20-/m0/s1 |
| InChIKey | YFKHDFUWKALWDD-ZWOKBUDYSA-N |
| XLogP | 1.43 |
| TPSA | 133.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.53 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|