C30H39N5O5 — CID 170263586
N-[2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]amino]propan-2-yl]amino]-1-cyclopropyl-2-oxoethyl]-1H-indole-2-carboxamide (PubChem CID 170263586) has the molecular formula C30H39N5O5 and a molecular weight of 549.67 g/mol. Its IUPAC name is N-[2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]amino]propan-2-yl]amino]-1-cyclopropyl-2-oxoethyl]-1H-indole-2-carboxamide.
| Compound Name | N-[2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]amino]propan-2-yl]amino]-1-cyclopropyl-2-oxoethyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 170263586 |
| Molecular Formula | C30H39N5O5 |
| Molecular Weight | 549.67 g/mol |
| Exact Mass | 549.30 |
| IUPAC Name | N-[2-[[(2S)-3-cyclohexyl-1-oxo-1-[[(2S)-1-oxo-3-[(3S)-2-oxopyrrolidin-3-yl]propan-2-yl]amino]propan-2-yl]amino]-1-cyclopropyl-2-oxoethyl]-1H-indole-2-carboxamide |
| SMILES | O=C[C@H](C[C@@H]1CCNC1=O)NC(=O)[C@H](CC1CCCCC1)NC(=O)C(NC(=O)c1cc2ccccc2[nH]1)C1CC1 |
| InChI | InChI=1S/C30H39N5O5/c36-17-22(15-21-12-13-31-27(21)37)32-28(38)24(14-18-6-2-1-3-7-18)34-30(40)26(19-10-11-19)35-29(39)25-16-20-8-4-5-9-23(20)33-25/h4-5,8-9,16-19,21-22,24,26,33H,1-3,6-7,10-15H2,(H,31,37)(H,32,38)(H,34,40)(H,35,39)/t21-,22-,24-,26?/m0/s1 |
| InChIKey | YGKMMXOPUZRKTE-NAPBUYQCSA-N |
| XLogP | 2.34 |
| TPSA | 149.26 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.67 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|