C25H30N4O4S — CID 172914161
(2S)-2-[[(2S)-3-[(1S)-cyclohex-3-en-1-yl]-2-(1H-indole-2-carbonylamino)propanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanethioic S-acid (PubChem CID 172914161) has the molecular formula C25H30N4O4S and a molecular weight of 482.61 g/mol. Its IUPAC name is (2S)-2-[[(2S)-3-[(1S)-cyclohex-3-en-1-yl]-2-(1H-indole-2-carbonylamino)propanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanethioic S-acid.
| Compound Name | (2S)-2-[[(2S)-3-[(1S)-cyclohex-3-en-1-yl]-2-(1H-indole-2-carbonylamino)propanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanethioic S-acid |
|---|---|
| PubChem CID | 172914161 |
| Molecular Formula | C25H30N4O4S |
| Molecular Weight | 482.61 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | (2S)-2-[[(2S)-3-[(1S)-cyclohex-3-en-1-yl]-2-(1H-indole-2-carbonylamino)propanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanethioic S-acid |
| SMILES | O=C(N[C@@H](C[C@@H]1CC=CCC1)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)S)c1cc2ccccc2[nH]1 |
| InChI | InChI=1S/C25H30N4O4S/c30-22-17(10-11-26-22)14-21(25(33)34)29-23(31)19(12-15-6-2-1-3-7-15)28-24(32)20-13-16-8-4-5-9-18(16)27-20/h1-2,4-5,8-9,13,15,17,19,21,27H,3,6-7,10-12,14H2,(H,26,30)(H,28,32)(H,29,31)(H,33,34)/t15-,17+,19+,21+/m1/s1 |
| InChIKey | IUJCHZUWHYNXGY-UCKNYWNBSA-N |
| XLogP | 2.48 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.61 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|