C27H37N5O5S — CID 146037596
(2S)-2-[[(2S)-2-[[(2S)-2-(1H-indole-2-carbonylamino)-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanethioic S-acid (PubChem CID 146037596) has the molecular formula C27H37N5O5S and a molecular weight of 543.69 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-[[(2S)-2-(1H-indole-2-carbonylamino)-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanethioic S-acid.
| Compound Name | (2S)-2-[[(2S)-2-[[(2S)-2-(1H-indole-2-carbonylamino)-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanethioic S-acid |
|---|---|
| PubChem CID | 146037596 |
| Molecular Formula | C27H37N5O5S |
| Molecular Weight | 543.69 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | (2S)-2-[[(2S)-2-[[(2S)-2-(1H-indole-2-carbonylamino)-3-methylbutanoyl]amino]-4-methylpentanoyl]amino]-3-[(3S)-2-oxopyrrolidin-3-yl]propanethioic S-acid |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](NC(=O)c1cc2ccccc2[nH]1)C(C)C)C(=O)N[C@@H](C[C@@H]1CCNC1=O)C(=O)S |
| InChI | InChI=1S/C27H37N5O5S/c1-14(2)11-19(24(34)31-21(27(37)38)13-17-9-10-28-23(17)33)30-26(36)22(15(3)4)32-25(35)20-12-16-7-5-6-8-18(16)29-20/h5-8,12,14-15,17,19,21-22,29H,9-11,13H2,1-4H3,(H,28,33)(H,30,36)(H,31,34)(H,32,35)(H,37,38)/t17-,19-,21-,22-/m0/s1 |
| InChIKey | GZURVAWSSQSVPV-UDDWMFPDSA-N |
| XLogP | 1.92 |
| TPSA | 149.26 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.69 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|